C17H24O5 — CID 101216576
(1R,7R,8S)-6,6-dimethoxy-3-(2-methyl-1,3-dioxolan-2-yl)tetracyclo[6.3.0.02,4.03,7]undecan-5-one (PubChem CID 101216576) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (1R,7R,8S)-6,6-dimethoxy-3-(2-methyl-1,3-dioxolan-2-yl)tetracyclo[6.3.0.02,4.03,7]undecan-5-one.
| Compound Name | (1R,7R,8S)-6,6-dimethoxy-3-(2-methyl-1,3-dioxolan-2-yl)tetracyclo[6.3.0.02,4.03,7]undecan-5-one |
|---|---|
| PubChem CID | 101216576 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (1R,7R,8S)-6,6-dimethoxy-3-(2-methyl-1,3-dioxolan-2-yl)tetracyclo[6.3.0.02,4.03,7]undecan-5-one |
| SMILES | COC1(OC)C(=O)C2C3C4CCC[C@@H]4[C@@H]1C23C1(C)OCCO1 |
| InChI | InChI=1S/C17H24O5/c1-15(21-7-8-22-15)16-11-9-5-4-6-10(9)13(16)17(19-2,20-3)14(18)12(11)16/h9-13H,4-8H2,1-3H3/t9?,10-,11?,12?,13+,16?/m0/s1 |
| InChIKey | YBBSHFVKDDBKCB-DIPXMCQWSA-N |
| XLogP | 1.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|