C20H28O5 — CID 102046094
[(2'S,3'R,4S,4'S,7'R,8'R,9'R)-2,2,7',10',10'-pentamethyl-5'-oxospiro[1,3-dioxolane-4,6'-tetracyclo[6.3.0.02,4.03,7]undecane]-9'-yl] acetate (PubChem CID 102046094) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(2'S,3'R,4S,4'S,7'R,8'R,9'R)-2,2,7',10',10'-pentamethyl-5'-oxospiro[1,3-dioxolane-4,6'-tetracyclo[6.3.0.02,4.03,7]undecane]-9'-yl] acetate.
| Compound Name | [(2'S,3'R,4S,4'S,7'R,8'R,9'R)-2,2,7',10',10'-pentamethyl-5'-oxospiro[1,3-dioxolane-4,6'-tetracyclo[6.3.0.02,4.03,7]undecane]-9'-yl] acetate |
|---|---|
| PubChem CID | 102046094 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(2'S,3'R,4S,4'S,7'R,8'R,9'R)-2,2,7',10',10'-pentamethyl-5'-oxospiro[1,3-dioxolane-4,6'-tetracyclo[6.3.0.02,4.03,7]undecane]-9'-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2C(CC1(C)C)[C@@H]1[C@@H]3C(=O)[C@@]4(COC(C)(C)O4)[C@]2(C)[C@@H]31 |
| InChI | InChI=1S/C20H28O5/c1-9(21)24-16-13-10(7-17(16,2)3)11-12-14(11)19(13,6)20(15(12)22)8-23-18(4,5)25-20/h10-14,16H,7-8H2,1-6H3/t10?,11-,12+,13+,14-,16-,19+,20+/m1/s1 |
| InChIKey | ZYPAXICBKKYVRD-DVZBLWFASA-N |
| XLogP | 2.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |