C17H24O5 — CID 102046093
[(2S,3R,4S,6S,7R,8R,9R)-6-hydroxy-6-(hydroxymethyl)-7,10,10-trimethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate (PubChem CID 102046093) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(2S,3R,4S,6S,7R,8R,9R)-6-hydroxy-6-(hydroxymethyl)-7,10,10-trimethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate.
| Compound Name | [(2S,3R,4S,6S,7R,8R,9R)-6-hydroxy-6-(hydroxymethyl)-7,10,10-trimethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate |
|---|---|
| PubChem CID | 102046093 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(2S,3R,4S,6S,7R,8R,9R)-6-hydroxy-6-(hydroxymethyl)-7,10,10-trimethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2C(CC1(C)C)[C@@H]1[C@@H]3C(=O)[C@@](O)(CO)[C@]2(C)[C@@H]31 |
| InChI | InChI=1S/C17H24O5/c1-7(19)22-14-11-8(5-15(14,2)3)9-10-12(9)16(11,4)17(21,6-18)13(10)20/h8-12,14,18,21H,5-6H2,1-4H3/t8?,9-,10+,11+,12-,14-,16+,17+/m1/s1 |
| InChIKey | KAWODFPKBVVPNX-PRFOYRJFSA-N |
| XLogP | 0.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |