C16H20O2 — CID 101216581
(1S,6S,8S,9R,10S,14R)-8-hydroxy-4-methyltetracyclo[7.6.0.01,6.010,14]pentadeca-3,12-dien-2-one (PubChem CID 101216581) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1S,6S,8S,9R,10S,14R)-8-hydroxy-4-methyltetracyclo[7.6.0.01,6.010,14]pentadeca-3,12-dien-2-one.
| Compound Name | (1S,6S,8S,9R,10S,14R)-8-hydroxy-4-methyltetracyclo[7.6.0.01,6.010,14]pentadeca-3,12-dien-2-one |
|---|---|
| PubChem CID | 101216581 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1S,6S,8S,9R,10S,14R)-8-hydroxy-4-methyltetracyclo[7.6.0.01,6.010,14]pentadeca-3,12-dien-2-one |
| SMILES | CC1=CC(=O)[C@]23C[C@@H]4C=CC[C@@H]4[C@H]2[C@@H](O)C[C@@H]3C1 |
| InChI | InChI=1S/C16H20O2/c1-9-5-11-7-13(17)15-12-4-2-3-10(12)8-16(11,15)14(18)6-9/h2-3,6,10-13,15,17H,4-5,7-8H2,1H3/t10-,11-,12-,13-,15-,16+/m0/s1 |
| InChIKey | UHSUYNTWJIFBAD-JKPJVAMOSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|