C8H5F7O4 — CID 101216707
2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl fluoride (PubChem CID 101216707) has the molecular formula C8H5F7O4 and a molecular weight of 298.11 g/mol. Its IUPAC name is 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl fluoride.
| Compound Name | 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl fluoride |
|---|---|
| PubChem CID | 101216707 |
| Molecular Formula | C8H5F7O4 |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetyl fluoride |
| SMILES | C[C@@]1(CC(=O)F)OC(C(F)(F)F)(C(F)(F)F)OC1=O |
| InChI | InChI=1S/C8H5F7O4/c1-5(2-3(9)16)4(17)18-6(19-5,7(10,11)12)8(13,14)15/h2H2,1H3/t5-/m0/s1 |
| InChIKey | JLLZFZWZFUKNDK-YFKPBYRVSA-N |
| XLogP | 2.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|