C20H20BF6NO — CID 101217839
piperidin-2-ylmethoxy-bis[4-(trifluoromethyl)phenyl]borane (PubChem CID 101217839) has the molecular formula C20H20BF6NO and a molecular weight of 415.19 g/mol. Its IUPAC name is piperidin-2-ylmethoxy-bis[4-(trifluoromethyl)phenyl]borane.
| Compound Name | piperidin-2-ylmethoxy-bis[4-(trifluoromethyl)phenyl]borane |
|---|---|
| PubChem CID | 101217839 |
| Molecular Formula | C20H20BF6NO |
| Molecular Weight | 415.19 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | piperidin-2-ylmethoxy-bis[4-(trifluoromethyl)phenyl]borane |
| SMILES | FC(F)(F)c1ccc(B(OCC2CCCCN2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H20BF6NO/c22-19(23,24)14-4-8-16(9-5-14)21(29-13-18-3-1-2-12-28-18)17-10-6-15(7-11-17)20(25,26)27/h4-11,18,28H,1-3,12-13H2 |
| InChIKey | GBKGCWAQWCGUDC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|