C12H15ClF3NO — CID 129319981
2-[[4-(trifluoromethyl)phenoxy]methyl]pyrrolidine;hydrochloride (PubChem CID 129319981) has the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)phenoxy]methyl]pyrrolidine;hydrochloride.
| Compound Name | 2-[[4-(trifluoromethyl)phenoxy]methyl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 129319981 |
| Molecular Formula | C12H15ClF3NO |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[[4-(trifluoromethyl)phenoxy]methyl]pyrrolidine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc(OCC2CCCN2)cc1 |
| InChI | InChI=1S/C12H14F3NO.ClH/c13-12(14,15)9-3-5-11(6-4-9)17-8-10-2-1-7-16-10;/h3-6,10,16H,1-2,7-8H2;1H |
| InChIKey | BPOPGOJDPMTYRI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |