C18H22ClNO2 — CID 69002051
2-[[4-(4-methylphenoxy)phenoxy]methyl]pyrrolidine;hydrochloride (PubChem CID 69002051) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 2-[[4-(4-methylphenoxy)phenoxy]methyl]pyrrolidine;hydrochloride.
| Compound Name | 2-[[4-(4-methylphenoxy)phenoxy]methyl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 69002051 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[[4-(4-methylphenoxy)phenoxy]methyl]pyrrolidine;hydrochloride |
| SMILES | Cc1ccc(Oc2ccc(OCC3CCCN3)cc2)cc1.Cl |
| InChI | InChI=1S/C18H21NO2.ClH/c1-14-4-6-17(7-5-14)21-18-10-8-16(9-11-18)20-13-15-3-2-12-19-15;/h4-11,15,19H,2-3,12-13H2,1H3;1H |
| InChIKey | GTZKQCYLDNPKQF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |