C19H22ClNO3 — CID 68998757
1-[4-[4-[[(2R)-pyrrolidin-2-yl]methoxy]phenoxy]phenyl]ethanone;hydrochloride (PubChem CID 68998757) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 1-[4-[4-[[(2R)-pyrrolidin-2-yl]methoxy]phenoxy]phenyl]ethanone;hydrochloride.
| Compound Name | 1-[4-[4-[[(2R)-pyrrolidin-2-yl]methoxy]phenoxy]phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 68998757 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[4-[4-[[(2R)-pyrrolidin-2-yl]methoxy]phenoxy]phenyl]ethanone;hydrochloride |
| SMILES | CC(=O)c1ccc(Oc2ccc(OC[C@H]3CCCN3)cc2)cc1.Cl |
| InChI | InChI=1S/C19H21NO3.ClH/c1-14(21)15-4-6-18(7-5-15)23-19-10-8-17(9-11-19)22-13-16-3-2-12-20-16;/h4-11,16,20H,2-3,12-13H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | FSAVFBHJIGGARN-PKLMIRHRSA-N |
| XLogP | 4.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |