C21H25F3N2O2 — CID 134389097
1-[4-(pyrrolidin-2-ylmethoxy)phenyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanamine (PubChem CID 134389097) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-[4-(pyrrolidin-2-ylmethoxy)phenyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanamine.
| Compound Name | 1-[4-(pyrrolidin-2-ylmethoxy)phenyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanamine |
|---|---|
| PubChem CID | 134389097 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[4-(pyrrolidin-2-ylmethoxy)phenyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanamine |
| SMILES | CC(NOCc1ccc(C(F)(F)F)cc1)c1ccc(OCC2CCCN2)cc1 |
| InChI | InChI=1S/C21H25F3N2O2/c1-15(26-28-13-16-4-8-18(9-5-16)21(22,23)24)17-6-10-20(11-7-17)27-14-19-3-2-12-25-19/h4-11,15,19,25-26H,2-3,12-14H2,1H3 |
| InChIKey | VCSNUSRMZDHJJE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|