C20H25NO4 — CID 101218036
dimethyl 1-butyl-7-phenyl-4,5-dihydroazepine-2,3-dicarboxylate (PubChem CID 101218036) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is dimethyl 1-butyl-7-phenyl-4,5-dihydroazepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-butyl-7-phenyl-4,5-dihydroazepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101218036 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | dimethyl 1-butyl-7-phenyl-4,5-dihydroazepine-2,3-dicarboxylate |
| SMILES | CCCCN1C(c2ccccc2)=CCCC(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C20H25NO4/c1-4-5-14-21-17(15-10-7-6-8-11-15)13-9-12-16(19(22)24-2)18(21)20(23)25-3/h6-8,10-11,13H,4-5,9,12,14H2,1-3H3 |
| InChIKey | LMHHAMHXKTYQAO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |