C27H35NO4Si — CID 101218123
tert-butyl 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 101218123) has the molecular formula C27H35NO4Si and a molecular weight of 465.67 g/mol. Its IUPAC name is tert-butyl 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 101218123 |
| Molecular Formula | C27H35NO4Si |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | tert-butyl 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-oxo-2,3-dihydropyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C27H35NO4Si/c1-26(2,3)32-25(30)28-19-21(17-18-24(28)29)20-31-33(27(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-18,21H,19-20H2,1-6H3 |
| InChIKey | GZBJAUFTMSJKKX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|