C20H32O4 — CID 101218946
(4aS,7S)-7-(1,2-dihydroxyethyl)-7-(hydroxymethyl)-1,1,4a-trimethyl-2,3,4,5,6,8,10,10a-octahydrophenanthren-9-one (PubChem CID 101218946) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (4aS,7S)-7-(1,2-dihydroxyethyl)-7-(hydroxymethyl)-1,1,4a-trimethyl-2,3,4,5,6,8,10,10a-octahydrophenanthren-9-one.
| Compound Name | (4aS,7S)-7-(1,2-dihydroxyethyl)-7-(hydroxymethyl)-1,1,4a-trimethyl-2,3,4,5,6,8,10,10a-octahydrophenanthren-9-one |
|---|---|
| PubChem CID | 101218946 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (4aS,7S)-7-(1,2-dihydroxyethyl)-7-(hydroxymethyl)-1,1,4a-trimethyl-2,3,4,5,6,8,10,10a-octahydrophenanthren-9-one |
| SMILES | CC1(C)CCC[C@]2(C)C3=C(C[C@@](CO)(C(O)CO)CC3)C(=O)CC12 |
| InChI | InChI=1S/C20H32O4/c1-18(2)6-4-7-19(3)14-5-8-20(12-22,17(24)11-21)10-13(14)15(23)9-16(18)19/h16-17,21-22,24H,4-12H2,1-3H3/t16?,17?,19-,20+/m1/s1 |
| InChIKey | BPRNABOULSQVIO-TZJYRCSTSA-N |
| XLogP | 2.60 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |