C13H12O3 — CID 101219415
(4E)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-oxolane] (PubChem CID 101219415) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (4E)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-oxolane].
| Compound Name | (4E)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-oxolane] |
|---|---|
| PubChem CID | 101219415 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (4E)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,2'-oxolane] |
| SMILES | CC#CC#C/C=C1/OC2(CCCO2)C2OC12 |
| InChI | InChI=1S/C13H12O3/c1-2-3-4-5-7-10-11-12(15-11)13(16-10)8-6-9-14-13/h7,11-12H,6,8-9H2,1H3/b10-7+ |
| InChIKey | CNMPUOPTBQERPR-JXMROGBWSA-N |
| XLogP | 1.20 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|