C14H14O4 — CID 163080414
(1R,2R,3'S,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-ol (PubChem CID 163080414) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is (1R,2R,3'S,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-ol.
| Compound Name | (1R,2R,3'S,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-ol |
|---|---|
| PubChem CID | 163080414 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (1R,2R,3'S,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-ol |
| SMILES | CC#CC#CC=C1O[C@]2(CC[C@H](O)CO2)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C14H14O4/c1-2-3-4-5-6-11-12-13(17-12)14(18-11)8-7-10(15)9-16-14/h6,10,12-13,15H,7-9H2,1H3/t10-,12+,13+,14+/m0/s1 |
| InChIKey | MWGUGTQWSKWBQS-IGHBBLSQSA-N |
| XLogP | 0.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|