C14H16O5 — CID 162910250
(3R,4R,5S,8R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-3,4,8-triol (PubChem CID 162910250) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (3R,4R,5S,8R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-3,4,8-triol.
| Compound Name | (3R,4R,5S,8R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-3,4,8-triol |
|---|---|
| PubChem CID | 162910250 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (3R,4R,5S,8R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-3,4,8-triol |
| SMILES | CC#CC#CC=C1O[C@@]2(CC[C@@H](O)CO2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16O5/c1-2-3-4-5-6-11-12(16)13(17)14(19-11)8-7-10(15)9-18-14/h6,10,12-13,15-17H,7-9H2,1H3/t10-,12+,13-,14+/m1/s1 |
| InChIKey | GTFWQJQHSKVSMK-CABNGKKXSA-N |
| XLogP | -0.48 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|