C16H18O6 — CID 162990807
[(3R,4R,5S,8R)-2-hexa-2,4-diynylidene-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-8-yl] acetate (PubChem CID 162990807) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is [(3R,4R,5S,8R)-2-hexa-2,4-diynylidene-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-8-yl] acetate.
| Compound Name | [(3R,4R,5S,8R)-2-hexa-2,4-diynylidene-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-8-yl] acetate |
|---|---|
| PubChem CID | 162990807 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [(3R,4R,5S,8R)-2-hexa-2,4-diynylidene-3,4-dihydroxy-1,10-dioxaspiro[4.5]decan-8-yl] acetate |
| SMILES | CC#CC#CC=C1O[C@@]2(CC[C@@H](OC(C)=O)CO2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H18O6/c1-3-4-5-6-7-13-14(18)15(19)16(22-13)9-8-12(10-20-16)21-11(2)17/h7,12,14-15,18-19H,8-10H2,1-2H3/t12-,14+,15-,16+/m1/s1 |
| InChIKey | WQLLDCALTBJZIM-BVUBDWEXSA-N |
| XLogP | 0.09 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|