C16H17ClO5 — CID 162869444
[(3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,10-dioxaspiro[4.5]decan-8-yl] acetate (PubChem CID 162869444) has the molecular formula C16H17ClO5 and a molecular weight of 324.76 g/mol. Its IUPAC name is [(3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,10-dioxaspiro[4.5]decan-8-yl] acetate.
| Compound Name | [(3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,10-dioxaspiro[4.5]decan-8-yl] acetate |
|---|---|
| PubChem CID | 162869444 |
| Molecular Formula | C16H17ClO5 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | [(3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,10-dioxaspiro[4.5]decan-8-yl] acetate |
| SMILES | CC#CC#CC=C1O[C@@]2(CC[C@@H](OC(C)=O)CO2)[C@H](O)[C@H]1Cl |
| InChI | InChI=1S/C16H17ClO5/c1-3-4-5-6-7-13-14(17)15(19)16(22-13)9-8-12(10-20-16)21-11(2)18/h7,12,14-15,19H,8-10H2,1-2H3/t12-,14+,15-,16+/m1/s1 |
| InChIKey | TZXLQQXPYRGBRA-BVUBDWEXSA-N |
| XLogP | 1.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|