C14H15ClO3 — CID 10706900
(2E,3S,4R,5R)-3-chloro-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decan-4-ol (PubChem CID 10706900) has the molecular formula C14H15ClO3 and a molecular weight of 266.72 g/mol. Its IUPAC name is (2E,3S,4R,5R)-3-chloro-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decan-4-ol.
| Compound Name | (2E,3S,4R,5R)-3-chloro-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 10706900 |
| Molecular Formula | C14H15ClO3 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (2E,3S,4R,5R)-3-chloro-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decan-4-ol |
| SMILES | CC#CC#C/C=C1/O[C@]2(CCCCO2)[C@@H](O)[C@@H]1Cl |
| InChI | InChI=1S/C14H15ClO3/c1-2-3-4-5-8-11-12(15)13(16)14(18-11)9-6-7-10-17-14/h8,12-13,16H,6-7,9-10H2,1H3/b11-8+/t12-,13+,14-/m1/s1 |
| InChIKey | DMMBZMGXTNBDKO-WUTXRSFBSA-N |
| XLogP | 1.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|