C14H15ClO4 — CID 162869453
(3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-4,8-diol (PubChem CID 162869453) has the molecular formula C14H15ClO4 and a molecular weight of 282.72 g/mol. Its IUPAC name is (3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-4,8-diol.
| Compound Name | (3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-4,8-diol |
|---|---|
| PubChem CID | 162869453 |
| Molecular Formula | C14H15ClO4 |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-4,8-diol |
| SMILES | CC#CC#CC=C1O[C@@]2(CC[C@@H](O)CO2)[C@H](O)[C@H]1Cl |
| InChI | InChI=1S/C14H15ClO4/c1-2-3-4-5-6-11-12(15)13(17)14(19-11)8-7-10(16)9-18-14/h6,10,12-13,16-17H,7-9H2,1H3/t10-,12+,13-,14+/m1/s1 |
| InChIKey | URBRVDONNWPCOF-CABNGKKXSA-N |
| XLogP | 0.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|