C19H23ClO5 — CID 162926026
[(3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,10-dioxaspiro[4.5]decan-8-yl] 3-methylbutanoate (PubChem CID 162926026) has the molecular formula C19H23ClO5 and a molecular weight of 366.84 g/mol. Its IUPAC name is [(3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,10-dioxaspiro[4.5]decan-8-yl] 3-methylbutanoate.
| Compound Name | [(3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,10-dioxaspiro[4.5]decan-8-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 162926026 |
| Molecular Formula | C19H23ClO5 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [(3R,4S,5S,8R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,10-dioxaspiro[4.5]decan-8-yl] 3-methylbutanoate |
| SMILES | CC#CC#CC=C1O[C@@]2(CC[C@@H](OC(=O)CC(C)C)CO2)[C@H](O)[C@H]1Cl |
| InChI | InChI=1S/C19H23ClO5/c1-4-5-6-7-8-15-17(20)18(22)19(25-15)10-9-14(12-23-19)24-16(21)11-13(2)3/h8,13-14,17-18,22H,9-12H2,1-3H3/t14-,17+,18-,19+/m1/s1 |
| InChIKey | YVJXNMWEYXCJGE-FDPIWHGQSA-N |
| XLogP | 2.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|