C15H28O5 — CID 78210125
(2R,3S,4S,5R,6E)-2-(hydroxymethyl)-6-nonylideneoxane-3,4,5-triol (PubChem CID 78210125) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is (2R,3S,4S,5R,6E)-2-(hydroxymethyl)-6-nonylideneoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6E)-2-(hydroxymethyl)-6-nonylideneoxane-3,4,5-triol |
|---|---|
| PubChem CID | 78210125 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (2R,3S,4S,5R,6E)-2-(hydroxymethyl)-6-nonylideneoxane-3,4,5-triol |
| SMILES | CCCCCCCC/C=C1/O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H28O5/c1-2-3-4-5-6-7-8-9-11-13(17)15(19)14(18)12(10-16)20-11/h9,12-19H,2-8,10H2,1H3/b11-9+/t12-,13+,14-,15-/m1/s1 |
| InChIKey | HHAHCGMOIOSUMU-SIEBDZCYSA-N |
| XLogP | 1.09 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|