C15H27FO5 — CID 78210126
(2E,3R,4S,5S,6R)-2-(1-fluorononylidene)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 78210126) has the molecular formula C15H27FO5 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2E,3R,4S,5S,6R)-2-(1-fluorononylidene)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2E,3R,4S,5S,6R)-2-(1-fluorononylidene)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 78210126 |
| Molecular Formula | C15H27FO5 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2E,3R,4S,5S,6R)-2-(1-fluorononylidene)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCCC/C(F)=C1\O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H27FO5/c1-2-3-4-5-6-7-8-10(16)15-14(20)13(19)12(18)11(9-17)21-15/h11-14,17-20H,2-9H2,1H3/b15-10+/t11-,12-,13+,14-/m1/s1 |
| InChIKey | AMTDUIJIXBQWPD-BBNGPJBFSA-N |
| XLogP | 1.39 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|