C8H13FO5 — CID 135033484
(2E,3R,4S,5S,6R)-2-(1-fluoroethylidene)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 135033484) has the molecular formula C8H13FO5 and a molecular weight of 208.18 g/mol. Its IUPAC name is (2E,3R,4S,5S,6R)-2-(1-fluoroethylidene)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2E,3R,4S,5S,6R)-2-(1-fluoroethylidene)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 135033484 |
| Molecular Formula | C8H13FO5 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (2E,3R,4S,5S,6R)-2-(1-fluoroethylidene)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C/C(F)=C1\O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H13FO5/c1-3(9)8-7(13)6(12)5(11)4(2-10)14-8/h4-7,10-13H,2H2,1H3/b8-3+/t4-,5-,6+,7-/m1/s1 |
| InChIKey | IAMITEAJFJZWCN-HAMJYNRJSA-N |
| XLogP | -1.34 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |