C11H20O5 — CID 135045649
(2R,3S,4S,5R,6Z)-2-(hydroxymethyl)-6-pentylideneoxane-3,4,5-triol (PubChem CID 135045649) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2R,3S,4S,5R,6Z)-2-(hydroxymethyl)-6-pentylideneoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6Z)-2-(hydroxymethyl)-6-pentylideneoxane-3,4,5-triol |
|---|---|
| PubChem CID | 135045649 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2R,3S,4S,5R,6Z)-2-(hydroxymethyl)-6-pentylideneoxane-3,4,5-triol |
| SMILES | CCCC/C=C1\O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O5/c1-2-3-4-5-7-9(13)11(15)10(14)8(6-12)16-7/h5,8-15H,2-4,6H2,1H3/b7-5-/t8-,9+,10-,11-/m1/s1 |
| InChIKey | MODRBVJCTXMHQK-FWPKVIAASA-N |
| XLogP | -0.47 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|