C11H19FO5 — CID 135045784
(2E,3R,4S,5S,6R)-2-(1-fluoropentylidene)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 135045784) has the molecular formula C11H19FO5 and a molecular weight of 250.27 g/mol. Its IUPAC name is (2E,3R,4S,5S,6R)-2-(1-fluoropentylidene)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2E,3R,4S,5S,6R)-2-(1-fluoropentylidene)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 135045784 |
| Molecular Formula | C11H19FO5 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2E,3R,4S,5S,6R)-2-(1-fluoropentylidene)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCC/C(F)=C1\O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19FO5/c1-2-3-4-6(12)11-10(16)9(15)8(14)7(5-13)17-11/h7-10,13-16H,2-5H2,1H3/b11-6+/t7-,8-,9+,10-/m1/s1 |
| InChIKey | ZJYVQHRJJWYZIH-FTAADRSNSA-N |
| XLogP | -0.17 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |