C9H13NO4 — CID 101221503
ethyl (2S,3R)-2,3-dihydroxy-3-(1H-pyrrol-2-yl)propanoate (PubChem CID 101221503) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is ethyl (2S,3R)-2,3-dihydroxy-3-(1H-pyrrol-2-yl)propanoate.
| Compound Name | ethyl (2S,3R)-2,3-dihydroxy-3-(1H-pyrrol-2-yl)propanoate |
|---|---|
| PubChem CID | 101221503 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | ethyl (2S,3R)-2,3-dihydroxy-3-(1H-pyrrol-2-yl)propanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)c1ccc[nH]1 |
| InChI | InChI=1S/C9H13NO4/c1-2-14-9(13)8(12)7(11)6-4-3-5-10-6/h3-5,7-8,10-12H,2H2,1H3/t7-,8+/m1/s1 |
| InChIKey | GTXPMZDXSHCQNC-SFYZADRCSA-N |
| XLogP | -0.03 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |