C28H33Br2ClN2O3 — CID 10122193
[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-(3,5-dimethoxycyclohexyl)methanone (PubChem CID 10122193) has the molecular formula C28H33Br2ClN2O3 and a molecular weight of 640.84 g/mol. Its IUPAC name is [4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-(3,5-dimethoxycyclohexyl)methanone.
| Compound Name | [4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-(3,5-dimethoxycyclohexyl)methanone |
|---|---|
| PubChem CID | 10122193 |
| Molecular Formula | C28H33Br2ClN2O3 |
| Molecular Weight | 640.84 g/mol |
| Exact Mass | 638.05 |
| IUPAC Name | [4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-(3,5-dimethoxycyclohexyl)methanone |
| SMILES | COC1CC(OC)CC(C(=O)N2CCC([C@H]3c4ncc(Br)cc4CCc4cc(Cl)cc(Br)c43)CC2)C1 |
| InChI | InChI=1S/C28H33Br2ClN2O3/c1-35-22-11-19(12-23(14-22)36-2)28(34)33-7-5-16(6-8-33)26-25-17(10-21(31)13-24(25)30)3-4-18-9-20(29)15-32-27(18)26/h9-10,13,15-16,19,22-23,26H,3-8,11-12,14H2,1-2H3/t19?,22?,23?,26-/m1/s1 |
| InChIKey | XBHUPGVKWZEYRG-INAMPLRISA-N |
| XLogP | 6.56 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.84 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |