C26H29Br2ClN2O3 — CID 10304401
[4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-(3,5-dihydroxycyclohexyl)methanone (PubChem CID 10304401) has the molecular formula C26H29Br2ClN2O3 and a molecular weight of 612.79 g/mol. Its IUPAC name is [4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-(3,5-dihydroxycyclohexyl)methanone.
| Compound Name | [4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-(3,5-dihydroxycyclohexyl)methanone |
|---|---|
| PubChem CID | 10304401 |
| Molecular Formula | C26H29Br2ClN2O3 |
| Molecular Weight | 612.79 g/mol |
| Exact Mass | 610.02 |
| IUPAC Name | [4-[(2R)-6,15-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-(3,5-dihydroxycyclohexyl)methanone |
| SMILES | O=C(C1CC(O)CC(O)C1)N1CCC([C@H]2c3ncc(Br)cc3CCc3cc(Cl)cc(Br)c32)CC1 |
| InChI | InChI=1S/C26H29Br2ClN2O3/c27-18-7-16-2-1-15-8-19(29)11-22(28)23(15)24(25(16)30-13-18)14-3-5-31(6-4-14)26(34)17-9-20(32)12-21(33)10-17/h7-8,11,13-14,17,20-21,24,32-33H,1-6,9-10,12H2/t17?,20?,21?,24-/m1/s1 |
| InChIKey | UZKIVCZANXDFGI-JGKGTHMRSA-N |
| XLogP | 5.25 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.79 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |