C29H40O3S — CID 101222035
[(3S,8R,9S,10R,13R,14S,17S)-17-[(1R)-1-hydroxyethyl]-10-methyl-13-(phenylsulfanylmethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 101222035) has the molecular formula C29H40O3S and a molecular weight of 468.70 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13R,14S,17S)-17-[(1R)-1-hydroxyethyl]-10-methyl-13-(phenylsulfanylmethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13R,14S,17S)-17-[(1R)-1-hydroxyethyl]-10-methyl-13-(phenylsulfanylmethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 101222035 |
| Molecular Formula | C29H40O3S |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [(3S,8R,9S,10R,13R,14S,17S)-17-[(1R)-1-hydroxyethyl]-10-methyl-13-(phenylsulfanylmethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@@H](C)O)[C@@]4(CSc4ccccc4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H40O3S/c1-19(30)25-11-12-27-24-10-9-21-17-22(32-20(2)31)13-15-28(21,3)26(24)14-16-29(25,27)18-33-23-7-5-4-6-8-23/h4-9,19,22,24-27,30H,10-18H2,1-3H3/t19-,22+,24-,25-,26+,27+,28+,29+/m1/s1 |
| InChIKey | NCFQOPPOGVOFFI-FWVJAUPQSA-N |
| XLogP | 6.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|