C18H22O6 — CID 101222665
(1R,3S,6E,9R,13S,17S)-17-hydroxy-9-prop-1-en-2-yl-4,16-dioxatricyclo[11.2.1.13,6]heptadec-6-ene-5,11,14-trione (PubChem CID 101222665) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is (1R,3S,6E,9R,13S,17S)-17-hydroxy-9-prop-1-en-2-yl-4,16-dioxatricyclo[11.2.1.13,6]heptadec-6-ene-5,11,14-trione.
| Compound Name | (1R,3S,6E,9R,13S,17S)-17-hydroxy-9-prop-1-en-2-yl-4,16-dioxatricyclo[11.2.1.13,6]heptadec-6-ene-5,11,14-trione |
|---|---|
| PubChem CID | 101222665 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1R,3S,6E,9R,13S,17S)-17-hydroxy-9-prop-1-en-2-yl-4,16-dioxatricyclo[11.2.1.13,6]heptadec-6-ene-5,11,14-trione |
| SMILES | C=C(C)[C@@H]1C/C=C2/C(=O)O[C@@H](C[C@@H]3CC(=O)[C@H](CC(=O)C1)O3)[C@H]2O |
| InChI | InChI=1S/C18H22O6/c1-9(2)10-3-4-13-17(21)16(24-18(13)22)8-12-7-14(20)15(23-12)6-11(19)5-10/h4,10,12,15-17,21H,1,3,5-8H2,2H3/b13-4+/t10-,12+,15+,16+,17+/m1/s1 |
| InChIKey | POAZYRAHXVLQMG-YFTZIKLHSA-N |
| XLogP | 1.26 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|