C23H34O8 — CID 101223774
[(1S,2S,5R,6S,8S,9S,10S,11R,12R,15R)-9,10,15-trihydroxy-6-(methoxymethyl)-12-methyl-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate (PubChem CID 101223774) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is [(1S,2S,5R,6S,8S,9S,10S,11R,12R,15R)-9,10,15-trihydroxy-6-(methoxymethyl)-12-methyl-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate.
| Compound Name | [(1S,2S,5R,6S,8S,9S,10S,11R,12R,15R)-9,10,15-trihydroxy-6-(methoxymethyl)-12-methyl-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate |
|---|---|
| PubChem CID | 101223774 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [(1S,2S,5R,6S,8S,9S,10S,11R,12R,15R)-9,10,15-trihydroxy-6-(methoxymethyl)-12-methyl-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate |
| SMILES | COC[C@H]1C(=O)[C@]23C[C@H]1CC[C@H]2[C@@]12CO[C@]3(O)[C@@H](O)[C@@H]1[C@](C)(COC(C)=O)CC[C@H]2O |
| InChI | InChI=1S/C23H34O8/c1-12(24)30-10-20(2)7-6-16(25)21-11-31-23(28,19(27)17(20)21)22-8-13(4-5-15(21)22)14(9-29-3)18(22)26/h13-17,19,25,27-28H,4-11H2,1-3H3/t13-,14-,15+,16-,17-,19+,20+,21-,22+,23-/m1/s1 |
| InChIKey | QUXWIWHCRYAGON-ABGPSEMLSA-N |
| XLogP | 0.65 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |