C24H34O8 — CID 162864954
[(1S,4S,7R,8R,9R,12S,13S,16R,17S)-17-(ethoxymethyl)-9-hydroxy-7-methyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-7-yl]methyl acetate (PubChem CID 162864954) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(1S,4S,7R,8R,9R,12S,13S,16R,17S)-17-(ethoxymethyl)-9-hydroxy-7-methyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-7-yl]methyl acetate.
| Compound Name | [(1S,4S,7R,8R,9R,12S,13S,16R,17S)-17-(ethoxymethyl)-9-hydroxy-7-methyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-7-yl]methyl acetate |
|---|---|
| PubChem CID | 162864954 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1S,4S,7R,8R,9R,12S,13S,16R,17S)-17-(ethoxymethyl)-9-hydroxy-7-methyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-7-yl]methyl acetate |
| SMILES | CCOC[C@H]1C(=O)[C@]23C[C@H]1CC[C@H]2[C@@]12CO[C@@H](O)[C@@H]1[C@](C)(COC(C)=O)CC[C@@H]2OC3=O |
| InChI | InChI=1S/C24H34O8/c1-4-29-10-15-14-5-6-16-23(9-14,19(15)26)21(28)32-17-7-8-22(3,11-30-13(2)25)18-20(27)31-12-24(16,17)18/h14-18,20,27H,4-12H2,1-3H3/t14-,15-,16-,17+,18-,20-,22+,23+,24-/m1/s1 |
| InChIKey | MWNDFWLIFSQFOP-YJZZZSPHSA-N |
| XLogP | 1.86 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|