C22H30O8 — CID 163039239
(9,14-dihydroxy-7,17-dimethyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-7-yl)methyl acetate (PubChem CID 163039239) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is (9,14-dihydroxy-7,17-dimethyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-7-yl)methyl acetate.
| Compound Name | (9,14-dihydroxy-7,17-dimethyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-7-yl)methyl acetate |
|---|---|
| PubChem CID | 163039239 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (9,14-dihydroxy-7,17-dimethyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-7-yl)methyl acetate |
| SMILES | CC(=O)OCC1(C)CCC2OC(=O)C34CC(CC(O)C3C23COC(O)C13)C(C)C4=O |
| InChI | InChI=1S/C22H30O8/c1-10-12-6-13(24)15-21(7-12,17(10)25)19(27)30-14-4-5-20(3,8-28-11(2)23)16-18(26)29-9-22(14,15)16/h10,12-16,18,24,26H,4-9H2,1-3H3 |
| InChIKey | ZXTRCQHZIKZWRN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|