C23H32O9 — CID 22297725
[(4S,6S,9R,13S,14S,17S)-9,14-dihydroxy-17-(methoxymethyl)-7,7-dimethyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-6-yl] acetate (PubChem CID 22297725) has the molecular formula C23H32O9 and a molecular weight of 452.50 g/mol. Its IUPAC name is [(4S,6S,9R,13S,14S,17S)-9,14-dihydroxy-17-(methoxymethyl)-7,7-dimethyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-6-yl] acetate.
| Compound Name | [(4S,6S,9R,13S,14S,17S)-9,14-dihydroxy-17-(methoxymethyl)-7,7-dimethyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-6-yl] acetate |
|---|---|
| PubChem CID | 22297725 |
| Molecular Formula | C23H32O9 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [(4S,6S,9R,13S,14S,17S)-9,14-dihydroxy-17-(methoxymethyl)-7,7-dimethyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-6-yl] acetate |
| SMILES | COC[C@H]1C(=O)C23CC1C[C@H](O)[C@H]2C12CO[C@@H](O)C1C(C)(C)[C@@H](OC(C)=O)C[C@@H]2OC3=O |
| InChI | InChI=1S/C23H32O9/c1-10(24)31-14-6-15-23(9-30-19(27)17(23)21(14,2)3)16-13(25)5-11-7-22(16,20(28)32-15)18(26)12(11)8-29-4/h11-17,19,25,27H,5-9H2,1-4H3/t11?,12-,13+,14+,15+,16-,17?,19-,22?,23?/m1/s1 |
| InChIKey | LZAVQTOGXOKEMO-IZQJFHKRSA-N |
| XLogP | 0.44 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|