C24H21N2O5+ — CID 101224751
phenyl 2-[3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]pyridin-1-ium-1-yl]acetate (PubChem CID 101224751) has the molecular formula C24H21N2O5+ and a molecular weight of 417.44 g/mol. Its IUPAC name is phenyl 2-[3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]pyridin-1-ium-1-yl]acetate.
| Compound Name | phenyl 2-[3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]pyridin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 101224751 |
| Molecular Formula | C24H21N2O5+ |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | phenyl 2-[3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]pyridin-1-ium-1-yl]acetate |
| SMILES | O=C(C[n+]1cccc(C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)c1)Oc1ccccc1 |
| InChI | InChI=1S/C24H21N2O5/c27-22(31-21-11-5-2-6-12-21)16-25-13-7-10-19(15-25)23(28)26-20(17-30-24(26)29)14-18-8-3-1-4-9-18/h1-13,15,20H,14,16-17H2/q+1/t20-/m0/s1 |
| InChIKey | CYXPXDVLXQUZTJ-FQEVSTJZSA-N |
| XLogP | 2.78 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|