C21H25NO6 — CID 101225618
ethyl (2R,3R)-3-hydroxy-2-(4-methoxy-2-methylanilino)-4-(2-methoxyphenyl)-4-oxobutanoate (PubChem CID 101225618) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is ethyl (2R,3R)-3-hydroxy-2-(4-methoxy-2-methylanilino)-4-(2-methoxyphenyl)-4-oxobutanoate.
| Compound Name | ethyl (2R,3R)-3-hydroxy-2-(4-methoxy-2-methylanilino)-4-(2-methoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 101225618 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | ethyl (2R,3R)-3-hydroxy-2-(4-methoxy-2-methylanilino)-4-(2-methoxyphenyl)-4-oxobutanoate |
| SMILES | CCOC(=O)[C@H](Nc1ccc(OC)cc1C)[C@@H](O)C(=O)c1ccccc1OC |
| InChI | InChI=1S/C21H25NO6/c1-5-28-21(25)18(22-16-11-10-14(26-3)12-13(16)2)20(24)19(23)15-8-6-7-9-17(15)27-4/h6-12,18,20,22,24H,5H2,1-4H3/t18-,20-/m1/s1 |
| InChIKey | YUHWFYUORGPAPW-UYAOXDASSA-N |
| XLogP | 2.60 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|