C31H27Br2ClO5 — CID 10122601
2-[3,5-dibromo-4-[2-[(4-chloro-2-hydroxyphenyl)-phenylmethyl]-4-methoxy-5-propan-2-ylphenoxy]phenyl]acetic acid (PubChem CID 10122601) has the molecular formula C31H27Br2ClO5 and a molecular weight of 674.81 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[2-[(4-chloro-2-hydroxyphenyl)-phenylmethyl]-4-methoxy-5-propan-2-ylphenoxy]phenyl]acetic acid.
| Compound Name | 2-[3,5-dibromo-4-[2-[(4-chloro-2-hydroxyphenyl)-phenylmethyl]-4-methoxy-5-propan-2-ylphenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 10122601 |
| Molecular Formula | C31H27Br2ClO5 |
| Molecular Weight | 674.81 g/mol |
| Exact Mass | 671.99 |
| IUPAC Name | 2-[3,5-dibromo-4-[2-[(4-chloro-2-hydroxyphenyl)-phenylmethyl]-4-methoxy-5-propan-2-ylphenoxy]phenyl]acetic acid |
| SMILES | COc1cc(C(c2ccccc2)c2ccc(Cl)cc2O)c(Oc2c(Br)cc(CC(=O)O)cc2Br)cc1C(C)C |
| InChI | InChI=1S/C31H27Br2ClO5/c1-17(2)22-15-28(39-31-24(32)11-18(12-25(31)33)13-29(36)37)23(16-27(22)38-3)30(19-7-5-4-6-8-19)21-10-9-20(34)14-26(21)35/h4-12,14-17,30,35H,13H2,1-3H3,(H,36,37) |
| InChIKey | ZPAKRMIRDSYILD-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.81 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|