C25H25FIN7O7 — CID 10122642
[2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl] 4-azido-2-hydroxy-5-(125I)iodobenzoate (PubChem CID 10122642) has the molecular formula C25H25FIN7O7 and a molecular weight of 679.42 g/mol. Its IUPAC name is [2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl] 4-azido-2-hydroxy-5-(125I)iodobenzoate.
| Compound Name | [2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl] 4-azido-2-hydroxy-5-(125I)iodobenzoate |
|---|---|
| PubChem CID | 10122642 |
| Molecular Formula | C25H25FIN7O7 |
| Molecular Weight | 679.42 g/mol |
| Exact Mass | 679.08 |
| IUPAC Name | [2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl] 4-azido-2-hydroxy-5-(125I)iodobenzoate |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)COC(=O)c4cc([125I])c(N=[N+]=[N-])cc4O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H25FIN7O7/c1-14(35)29-11-16-12-34(25(39)41-16)15-2-3-21(18(26)8-15)32-4-6-33(7-5-32)23(37)13-40-24(38)17-9-19(27)20(30-31-28)10-22(17)36/h2-3,8-10,16,36H,4-7,11-13H2,1H3,(H,29,35)/t16-/m0/s1/i27-2 |
| InChIKey | VDTBBCYQZRIVAU-WFTGWBJOSA-N |
| XLogP | 3.04 |
| TPSA | 177.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|