C20H25F3N4O5S — CID 76547544
[2-[4-[4-[5-[[(2,2-difluoro-1-sulfanylethyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl] acetate (PubChem CID 76547544) has the molecular formula C20H25F3N4O5S and a molecular weight of 490.50 g/mol. Its IUPAC name is [2-[4-[4-[5-[[(2,2-difluoro-1-sulfanylethyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[4-[4-[5-[[(2,2-difluoro-1-sulfanylethyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 76547544 |
| Molecular Formula | C20H25F3N4O5S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | [2-[4-[4-[5-[[(2,2-difluoro-1-sulfanylethyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)N1CCN(c2ccc(N3CC(CNC(S)C(F)F)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H25F3N4O5S/c1-12(28)31-11-17(29)26-6-4-25(5-7-26)16-3-2-13(8-15(16)21)27-10-14(32-20(27)30)9-24-19(33)18(22)23/h2-3,8,14,18-19,24,33H,4-7,9-11H2,1H3 |
| InChIKey | VIKRQRDHRMZZJX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|