C26H29F3N4O5S — CID 90704455
1-[4-[4-[(5S)-5-[[(2,2-difluoro-1-sulfanylethyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-4-(3-hydroxyphenyl)butane-1,4-dione (PubChem CID 90704455) has the molecular formula C26H29F3N4O5S and a molecular weight of 566.60 g/mol. Its IUPAC name is 1-[4-[4-[(5S)-5-[[(2,2-difluoro-1-sulfanylethyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-4-(3-hydroxyphenyl)butane-1,4-dione.
| Compound Name | 1-[4-[4-[(5S)-5-[[(2,2-difluoro-1-sulfanylethyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-4-(3-hydroxyphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 90704455 |
| Molecular Formula | C26H29F3N4O5S |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 1-[4-[4-[(5S)-5-[[(2,2-difluoro-1-sulfanylethyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-4-(3-hydroxyphenyl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCN(c2ccc(N3C[C@H](CNC(S)C(F)F)OC3=O)cc2F)CC1)c1cccc(O)c1 |
| InChI | InChI=1S/C26H29F3N4O5S/c27-20-13-17(33-15-19(38-26(33)37)14-30-25(39)24(28)29)4-5-21(20)31-8-10-32(11-9-31)23(36)7-6-22(35)16-2-1-3-18(34)12-16/h1-5,12-13,19,24-25,30,34,39H,6-11,14-15H2/t19-,25?/m0/s1 |
| InChIKey | MTOZAEIPGXNXRM-UBDBMELISA-N |
| XLogP | 3.28 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|