C30H41FN6O4S — CID 91609393
2-(dimethylamino)-N-[4-[4-[4-[2-fluoro-4-[2-oxo-5-[(1-sulfanylethylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-4-oxobutyl]phenyl]acetamide (PubChem CID 91609393) has the molecular formula C30H41FN6O4S and a molecular weight of 600.76 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[4-[4-[4-[2-fluoro-4-[2-oxo-5-[(1-sulfanylethylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-4-oxobutyl]phenyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[4-[4-[4-[2-fluoro-4-[2-oxo-5-[(1-sulfanylethylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-4-oxobutyl]phenyl]acetamide |
|---|---|
| PubChem CID | 91609393 |
| Molecular Formula | C30H41FN6O4S |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 2-(dimethylamino)-N-[4-[4-[4-[2-fluoro-4-[2-oxo-5-[(1-sulfanylethylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-4-oxobutyl]phenyl]acetamide |
| SMILES | CC(S)NCC1CN(c2ccc(N3CCN(C(=O)CCCc4ccc(NC(=O)CN(C)C)cc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C30H41FN6O4S/c1-21(42)32-18-25-19-37(30(40)41-25)24-11-12-27(26(31)17-24)35-13-15-36(16-14-35)29(39)6-4-5-22-7-9-23(10-8-22)33-28(38)20-34(2)3/h7-12,17,21,25,32,42H,4-6,13-16,18-20H2,1-3H3,(H,33,38) |
| InChIKey | OZHFKDXLDPXRCD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|