C13H22O7 — CID 101228474
methyl 2-[(3aS,4R,6S,6aR)-6-(hydroxymethyl)-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetate (PubChem CID 101228474) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is methyl 2-[(3aS,4R,6S,6aR)-6-(hydroxymethyl)-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetate.
| Compound Name | methyl 2-[(3aS,4R,6S,6aR)-6-(hydroxymethyl)-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetate |
|---|---|
| PubChem CID | 101228474 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | methyl 2-[(3aS,4R,6S,6aR)-6-(hydroxymethyl)-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-4-yl]acetate |
| SMILES | COC(=O)C[C@@]1(OC)O[C@@](C)(CO)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C13H22O7/c1-11(2)18-9-10(19-11)13(17-5,6-8(15)16-4)20-12(9,3)7-14/h9-10,14H,6-7H2,1-5H3/t9-,10+,12+,13-/m1/s1 |
| InChIKey | JEIKEUALYXYRRZ-RSLMWUCJSA-N |
| XLogP | 0.19 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |