C20H29NO6 — CID 101200381
methyl 2-[(3aR,4R,6S,6aR)-4-(benzylamino)-6-[(1R)-1-methoxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate (PubChem CID 101200381) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,6S,6aR)-4-(benzylamino)-6-[(1R)-1-methoxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate.
| Compound Name | methyl 2-[(3aR,4R,6S,6aR)-4-(benzylamino)-6-[(1R)-1-methoxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate |
|---|---|
| PubChem CID | 101200381 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | methyl 2-[(3aR,4R,6S,6aR)-4-(benzylamino)-6-[(1R)-1-methoxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate |
| SMILES | COC(=O)C[C@@]1(NCc2ccccc2)O[C@@H]([C@@H](C)OC)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H29NO6/c1-13(23-4)16-17-18(27-19(2,3)25-17)20(26-16,11-15(22)24-5)21-12-14-9-7-6-8-10-14/h6-10,13,16-18,21H,11-12H2,1-5H3/t13-,16+,17-,18-,20-/m1/s1 |
| InChIKey | QBBKTMPQDJUFQN-QTUIHCGYSA-N |
| XLogP | 1.99 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |