C41H33F6N3O2 — CID 10122931
N-(2,2,2-trifluoroethyl)-9-[3-[5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-2,3-dihydroindol-1-yl]propyl]fluorene-9-carboxamide (PubChem CID 10122931) has the molecular formula C41H33F6N3O2 and a molecular weight of 713.72 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-9-[3-[5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-2,3-dihydroindol-1-yl]propyl]fluorene-9-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-9-[3-[5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-2,3-dihydroindol-1-yl]propyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 10122931 |
| Molecular Formula | C41H33F6N3O2 |
| Molecular Weight | 713.72 g/mol |
| Exact Mass | 713.25 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-9-[3-[5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]-2,3-dihydroindol-1-yl]propyl]fluorene-9-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCN2CCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C41H33F6N3O2/c42-40(43,44)25-48-38(52)39(34-12-5-3-9-31(34)32-10-4-6-13-35(32)39)21-7-22-50-23-20-27-24-29(18-19-36(27)50)49-37(51)33-11-2-1-8-30(33)26-14-16-28(17-15-26)41(45,46)47/h1-6,8-19,24H,7,20-23,25H2,(H,48,52)(H,49,51) |
| InChIKey | HUVGWHQZLVXRTH-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.72 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|