C19H18F3NO4S — CID 101230074
ethyl (Z)-3-[(4-methylphenyl)sulfonylamino]-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 101230074) has the molecular formula C19H18F3NO4S and a molecular weight of 413.42 g/mol. Its IUPAC name is ethyl (Z)-3-[(4-methylphenyl)sulfonylamino]-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(4-methylphenyl)sulfonylamino]-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 101230074 |
| Molecular Formula | C19H18F3NO4S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | ethyl (Z)-3-[(4-methylphenyl)sulfonylamino]-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\NS(=O)(=O)c1ccc(C)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3NO4S/c1-3-27-18(24)12-17(14-5-4-6-15(11-14)19(20,21)22)23-28(25,26)16-9-7-13(2)8-10-16/h4-12,23H,3H2,1-2H3/b17-12- |
| InChIKey | RSMXFGJGIAEILA-ATVHPVEESA-N |
| XLogP | 3.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|