C18H18FNO4S — CID 101230078
ethyl (Z)-3-(4-fluorophenyl)-3-[(4-methylphenyl)sulfonylamino]prop-2-enoate (PubChem CID 101230078) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is ethyl (Z)-3-(4-fluorophenyl)-3-[(4-methylphenyl)sulfonylamino]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(4-fluorophenyl)-3-[(4-methylphenyl)sulfonylamino]prop-2-enoate |
|---|---|
| PubChem CID | 101230078 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | ethyl (Z)-3-(4-fluorophenyl)-3-[(4-methylphenyl)sulfonylamino]prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\NS(=O)(=O)c1ccc(C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FNO4S/c1-3-24-18(21)12-17(14-6-8-15(19)9-7-14)20-25(22,23)16-10-4-13(2)5-11-16/h4-12,20H,3H2,1-2H3/b17-12- |
| InChIKey | MPGZSXOSCUQHDK-ATVHPVEESA-N |
| XLogP | 3.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|