C20H21NO4S — CID 101269451
ethyl (2E)-2-[1-(4-methylphenyl)sulfonyl-4-phenylazetidin-2-ylidene]acetate (PubChem CID 101269451) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl (2E)-2-[1-(4-methylphenyl)sulfonyl-4-phenylazetidin-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[1-(4-methylphenyl)sulfonyl-4-phenylazetidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 101269451 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethyl (2E)-2-[1-(4-methylphenyl)sulfonyl-4-phenylazetidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CC(c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO4S/c1-3-25-20(22)14-17-13-19(16-7-5-4-6-8-16)21(17)26(23,24)18-11-9-15(2)10-12-18/h4-12,14,19H,3,13H2,1-2H3/b17-14+ |
| InChIKey | XNNZFCYHCLLVJV-SAPNQHFASA-N |
| XLogP | 3.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|