C22H19ClN2O — CID 101231199
3-(3-chlorophenyl)-5,5-bis(4-methylphenyl)-2H-1,2,4-oxadiazole (PubChem CID 101231199) has the molecular formula C22H19ClN2O and a molecular weight of 362.86 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5,5-bis(4-methylphenyl)-2H-1,2,4-oxadiazole.
| Compound Name | 3-(3-chlorophenyl)-5,5-bis(4-methylphenyl)-2H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 101231199 |
| Molecular Formula | C22H19ClN2O |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-(3-chlorophenyl)-5,5-bis(4-methylphenyl)-2H-1,2,4-oxadiazole |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)N=C(c3cccc(Cl)c3)NO2)cc1 |
| InChI | InChI=1S/C22H19ClN2O/c1-15-6-10-18(11-7-15)22(19-12-8-16(2)9-13-19)24-21(25-26-22)17-4-3-5-20(23)14-17/h3-14H,1-2H3,(H,24,25) |
| InChIKey | QDQJRCMHOUDHOE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |