C55H70NO8P — CID 101231275
[(1R,2S,3R,4S,5S,6R)-2-[[di(propan-2-yl)amino]-phenylmethoxyphosphanyl]oxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] octanoate (PubChem CID 101231275) has the molecular formula C55H70NO8P and a molecular weight of 904.14 g/mol. Its IUPAC name is [(1R,2S,3R,4S,5S,6R)-2-[[di(propan-2-yl)amino]-phenylmethoxyphosphanyl]oxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] octanoate.
| Compound Name | [(1R,2S,3R,4S,5S,6R)-2-[[di(propan-2-yl)amino]-phenylmethoxyphosphanyl]oxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] octanoate |
|---|---|
| PubChem CID | 101231275 |
| Molecular Formula | C55H70NO8P |
| Molecular Weight | 904.14 g/mol |
| Exact Mass | 903.48 |
| IUPAC Name | [(1R,2S,3R,4S,5S,6R)-2-[[di(propan-2-yl)amino]-phenylmethoxyphosphanyl]oxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohexyl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OP(OCc1ccccc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C55H70NO8P/c1-6-7-8-9-25-36-49(57)63-54-52(60-39-46-30-19-12-20-31-46)50(58-37-44-26-15-10-16-27-44)51(59-38-45-28-17-11-18-29-45)53(61-40-47-32-21-13-22-33-47)55(54)64-65(56(42(2)3)43(4)5)62-41-48-34-23-14-24-35-48/h10-24,26-35,42-43,50-55H,6-9,25,36-41H2,1-5H3/t50-,51-,52+,53+,54+,55-,65?/m0/s1 |
| InChIKey | JNBRBHWRRCDRGV-HLCABTLSSA-N |
| XLogP | 12.56 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.14 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|